C34H18N4O2 — CID 134243273
9-[1,3-dioxo-2-(4-phenylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile (PubChem CID 134243273) has the molecular formula C34H18N4O2 and a molecular weight of 514.54 g/mol. Its IUPAC name is 9-[1,3-dioxo-2-(4-phenylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile.
| Compound Name | 9-[1,3-dioxo-2-(4-phenylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 134243273 |
| Molecular Formula | C34H18N4O2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 9-[1,3-dioxo-2-(4-phenylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile |
| SMILES | N#Cc1cccc2c1c1c(C#N)cccc1n2-c1cccc2c1C(=O)N(c1ccc(-c3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C34H18N4O2/c35-19-23-9-4-12-27-30(23)31-24(20-36)10-5-13-28(31)38(27)29-14-6-11-26-32(29)34(40)37(33(26)39)25-17-15-22(16-18-25)21-7-2-1-3-8-21/h1-18H |
| InChIKey | LPASGVBIJJXKDL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|