C34H23N3O2 — CID 166989505
2-(1-cyanocarbazol-9-yl)-N-formyl-6-methyl-N-(3-phenylphenyl)benzamide (PubChem CID 166989505) has the molecular formula C34H23N3O2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-(1-cyanocarbazol-9-yl)-N-formyl-6-methyl-N-(3-phenylphenyl)benzamide.
| Compound Name | 2-(1-cyanocarbazol-9-yl)-N-formyl-6-methyl-N-(3-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 166989505 |
| Molecular Formula | C34H23N3O2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-(1-cyanocarbazol-9-yl)-N-formyl-6-methyl-N-(3-phenylphenyl)benzamide |
| SMILES | Cc1cccc(-n2c3ccccc3c3cccc(C#N)c32)c1C(=O)N(C=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C34H23N3O2/c1-23-10-7-19-31(37-30-18-6-5-16-28(30)29-17-9-14-26(21-35)33(29)37)32(23)34(39)36(22-38)27-15-8-13-25(20-27)24-11-3-2-4-12-24/h2-20,22H,1H3 |
| InChIKey | RSZDBICROHKHPF-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|