C41H26F6N2O2 — CID 142280555
2-[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-6-formyl-N-methyl-N-(4-phenylphenyl)benzamide (PubChem CID 142280555) has the molecular formula C41H26F6N2O2 and a molecular weight of 692.66 g/mol. Its IUPAC name is 2-[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-6-formyl-N-methyl-N-(4-phenylphenyl)benzamide.
| Compound Name | 2-[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-6-formyl-N-methyl-N-(4-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 142280555 |
| Molecular Formula | C41H26F6N2O2 |
| Molecular Weight | 692.66 g/mol |
| Exact Mass | 692.19 |
| IUPAC Name | 2-[3-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-6-formyl-N-methyl-N-(4-phenylphenyl)benzamide |
| SMILES | CN(C(=O)c1c(C=O)cccc1-n1c2ccccc2c2cc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)ccc21)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H26F6N2O2/c1-48(30-18-14-26(15-19-30)25-8-3-2-4-9-25)39(51)38-28(24-50)10-7-13-37(38)49-35-12-6-5-11-32(35)33-22-27(16-21-36(33)49)31-20-17-29(40(42,43)44)23-34(31)41(45,46)47/h2-24H,1H3 |
| InChIKey | MEBAFHILLISVTF-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.66 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|