C32H19F6N — CID 122431504
9-[2,5-bis(trifluoromethyl)phenyl]-3,6-diphenylcarbazole (PubChem CID 122431504) has the molecular formula C32H19F6N and a molecular weight of 531.50 g/mol. Its IUPAC name is 9-[2,5-bis(trifluoromethyl)phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2,5-bis(trifluoromethyl)phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 122431504 |
| Molecular Formula | C32H19F6N |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 9-[2,5-bis(trifluoromethyl)phenyl]-3,6-diphenylcarbazole |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C32H19F6N/c33-31(34,35)24-13-14-27(32(36,37)38)30(19-24)39-28-15-11-22(20-7-3-1-4-8-20)17-25(28)26-18-23(12-16-29(26)39)21-9-5-2-6-10-21/h1-19H |
| InChIKey | QFXIVGOTSGGVTQ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |