C59H32F15N — CID 170285384
3,6-bis[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-9-[2-(trifluoromethyl)phenyl]carbazole (PubChem CID 170285384) has the molecular formula C59H32F15N and a molecular weight of 1039.88 g/mol. Its IUPAC name is 3,6-bis[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-9-[2-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 3,6-bis[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-9-[2-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 170285384 |
| Molecular Formula | C59H32F15N |
| Molecular Weight | 1039.88 g/mol |
| Exact Mass | 1039.23 |
| IUPAC Name | 3,6-bis[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-9-[2-(trifluoromethyl)phenyl]carbazole |
| SMILES | FC(F)(F)c1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)cc(-c3ccc4c(c3)c3cc(-c5cc(-c6ccc(C(F)(F)F)cc6)cc(-c6ccc(C(F)(F)F)cc6)c5)ccc3n4-c3ccccc3C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C59H32F15N/c60-55(61,62)45-15-5-33(6-16-45)39-25-40(34-7-17-46(18-8-34)56(63,64)65)28-43(27-39)37-13-23-52-49(31-37)50-32-38(14-24-53(50)75(52)54-4-2-1-3-51(54)59(72,73)74)44-29-41(35-9-19-47(20-10-35)57(66,67)68)26-42(30-44)36-11-21-48(22-12-36)58(69,70)71/h1-32H |
| InChIKey | VDTVVAQYTVTZPY-UHFFFAOYSA-N |
| XLogP | 19.88 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.88 |
| LogP ≤ 5 | 19.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |