C62H47F6N — CID 170283688
9-(2-tert-butylphenyl)-3,6-bis[3-(2-methylphenyl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole (PubChem CID 170283688) has the molecular formula C62H47F6N and a molecular weight of 920.05 g/mol. Its IUPAC name is 9-(2-tert-butylphenyl)-3,6-bis[3-(2-methylphenyl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole.
| Compound Name | 9-(2-tert-butylphenyl)-3,6-bis[3-(2-methylphenyl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 170283688 |
| Molecular Formula | C62H47F6N |
| Molecular Weight | 920.05 g/mol |
| Exact Mass | 919.36 |
| IUPAC Name | 9-(2-tert-butylphenyl)-3,6-bis[3-(2-methylphenyl)-5-[2-(trifluoromethyl)phenyl]phenyl]carbazole |
| SMILES | Cc1ccccc1-c1cc(-c2ccc3c(c2)c2cc(-c4cc(-c5ccccc5C)cc(-c5ccccc5C(F)(F)F)c4)ccc2n3-c2ccccc2C(C)(C)C)cc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C62H47F6N/c1-38-16-6-8-18-48(38)44-30-42(32-46(34-44)50-20-10-12-22-54(50)61(63,64)65)40-26-28-57-52(36-40)53-37-41(27-29-58(53)69(57)59-25-15-14-24-56(59)60(3,4)5)43-31-45(49-19-9-7-17-39(49)2)35-47(33-43)51-21-11-13-23-55(51)62(66,67)68/h6-37H,1-5H3 |
| InChIKey | FFBLFZGLBAFIQM-UHFFFAOYSA-N |
| XLogP | 18.74 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.05 |
| LogP ≤ 5 | 18.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |