C71H71N — CID 169284823
3,6-bis[3,5-bis(2-tert-butylphenyl)phenyl]-9-[2-(trideuteriomethyl)phenyl]carbazole (PubChem CID 169284823) has the molecular formula C71H71N and a molecular weight of 941.37 g/mol. Its IUPAC name is 3,6-bis[3,5-bis(2-tert-butylphenyl)phenyl]-9-[2-(trideuteriomethyl)phenyl]carbazole.
| Compound Name | 3,6-bis[3,5-bis(2-tert-butylphenyl)phenyl]-9-[2-(trideuteriomethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 169284823 |
| Molecular Formula | C71H71N |
| Molecular Weight | 941.37 g/mol |
| Exact Mass | 940.58 |
| IUPAC Name | 3,6-bis[3,5-bis(2-tert-butylphenyl)phenyl]-9-[2-(trideuteriomethyl)phenyl]carbazole |
| SMILES | [2H]C([2H])([2H])c1ccccc1-n1c2ccc(-c3cc(-c4ccccc4C(C)(C)C)cc(-c4ccccc4C(C)(C)C)c3)cc2c2cc(-c3cc(-c4ccccc4C(C)(C)C)cc(-c4ccccc4C(C)(C)C)c3)ccc21 |
| InChI | InChI=1S/C71H71N/c1-46-24-14-23-33-65(46)72-66-36-34-47(49-38-51(55-25-15-19-29-61(55)68(2,3)4)42-52(39-49)56-26-16-20-30-62(56)69(5,6)7)44-59(66)60-45-48(35-37-67(60)72)50-40-53(57-27-17-21-31-63(57)70(8,9)10)43-54(41-50)58-28-18-22-32-64(58)71(11,12)13/h14-45H,1-13H3/i1D3 |
| InChIKey | JYAOARIKRCZNAY-FIBGUPNXSA-N |
| XLogP | 20.28 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.37 |
| LogP ≤ 5 | 20.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |