C50H34N4O2 — CID 134234561
4-[2,7-bis(3-methyl-4-pyridinyl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione (PubChem CID 134234561) has the molecular formula C50H34N4O2 and a molecular weight of 722.85 g/mol. Its IUPAC name is 4-[2,7-bis(3-methyl-4-pyridinyl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2,7-bis(3-methyl-4-pyridinyl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234561 |
| Molecular Formula | C50H34N4O2 |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | 4-[2,7-bis(3-methyl-4-pyridinyl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cnccc1-c1ccc2c3ccc(-c4ccncc4C)cc3n(-c3cccc4c3C(=O)N(c3cc(-c5ccccc5)cc(-c5ccccc5)c3)C4=O)c2c1 |
| InChI | InChI=1S/C50H34N4O2/c1-31-29-51-22-20-40(31)35-16-18-42-43-19-17-36(41-21-23-52-30-32(41)2)28-47(43)54(46(42)27-35)45-15-9-14-44-48(45)50(56)53(49(44)55)39-25-37(33-10-5-3-6-11-33)24-38(26-39)34-12-7-4-8-13-34/h3-30H,1-2H3 |
| InChIKey | PYIRTNBZYXGKDD-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|