About azanium 2-phenylphenolate
azanium 2-phenylphenolate (PubChem CID 70290125) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is azanium 2-phenylphenolate.
Molecular Properties
| Compound Name | azanium 2-phenylphenolate |
| PubChem CID | 70290125 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | azanium 2-phenylphenolate |
| SMILES | [NH4+].[O-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.H3N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;1H3 |
| InChIKey | WTPWCIBYJWGZHI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azanium 2-phenylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-phenylphenolate?
The IUPAC name of azanium 2-phenylphenolate (CID 70290125) is azanium 2-phenylphenolate.
What is the SMILES notation for azanium 2-phenylphenolate?
The canonical SMILES for azanium 2-phenylphenolate is [NH4+].[O-]c1ccccc1-c1ccccc1.
What is the InChIKey of azanium 2-phenylphenolate?
The InChIKey is WTPWCIBYJWGZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.H3N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;1H3.
What are the key properties of azanium 2-phenylphenolate?
azanium 2-phenylphenolate has a molecular weight of 187.24 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-phenylphenolate is sourced from PubChem (CID 70290125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).