C30H25OP — CID 87286180
phosphanium 2,3,4,5-tetraphenylphenolate (PubChem CID 87286180) has the molecular formula C30H25OP and a molecular weight of 432.50 g/mol. Its IUPAC name is phosphanium 2,3,4,5-tetraphenylphenolate.
| Compound Name | phosphanium 2,3,4,5-tetraphenylphenolate |
|---|---|
| PubChem CID | 87286180 |
| Molecular Formula | C30H25OP |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | phosphanium 2,3,4,5-tetraphenylphenolate |
| SMILES | [O-]c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.[PH4+] |
| InChI | InChI=1S/C30H22O.H3P/c31-27-21-26(22-13-5-1-6-14-22)28(23-15-7-2-8-16-23)30(25-19-11-4-12-20-25)29(27)24-17-9-3-10-18-24;/h1-21,31H;1H3 |
| InChIKey | IZGVQQPAQOXQRM-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|