C30H21LiO — CID 122517105
lithium 2,3,4,5-tetraphenylphenolate (PubChem CID 122517105) has the molecular formula C30H21LiO and a molecular weight of 404.44 g/mol. Its IUPAC name is lithium 2,3,4,5-tetraphenylphenolate.
| Compound Name | lithium 2,3,4,5-tetraphenylphenolate |
|---|---|
| PubChem CID | 122517105 |
| Molecular Formula | C30H21LiO |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | lithium 2,3,4,5-tetraphenylphenolate |
| SMILES | [Li+].[O-]c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H22O.Li/c31-27-21-26(22-13-5-1-6-14-22)28(23-15-7-2-8-16-23)30(25-19-11-4-12-20-25)29(27)24-17-9-3-10-18-24;/h1-21,31H;/q;+1/p-1 |
| InChIKey | NTPNIELWEGPCFO-UHFFFAOYSA-M |
| XLogP | 4.43 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |