C24H19OP — CID 87061436
3,4,5-triphenyl-2-phosphaniumylphenolate (PubChem CID 87061436) has the molecular formula C24H19OP and a molecular weight of 354.39 g/mol. Its IUPAC name is 3,4,5-triphenyl-2-phosphaniumylphenolate.
| Compound Name | 3,4,5-triphenyl-2-phosphaniumylphenolate |
|---|---|
| PubChem CID | 87061436 |
| Molecular Formula | C24H19OP |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3,4,5-triphenyl-2-phosphaniumylphenolate |
| SMILES | [O-]c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1[PH3+] |
| InChI | InChI=1S/C24H19OP/c25-21-16-20(17-10-4-1-5-11-17)22(18-12-6-2-7-13-18)23(24(21)26)19-14-8-3-9-15-19/h1-16,25H,26H2 |
| InChIKey | KFIIOTUZCCWXOJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|