sodium 2-(4-ethenylphenyl)phenolate

C14H11NaO — CID 142700332

IUPACsodium 2-(4-ethenylphenyl)phenolate
SMILESC=Cc1ccc(-c2ccccc2[O-])cc1.[Na+]
InChIInChI=1S/C14H12O.Na/c1-2-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15;/h2-10,15H,1H2;/q;+1/p-1
InChIKeyKDOPXZORNCEDKC-UHFFFAOYSA-M
MW218.23 g/mol
LogP0.07
Rot. Bonds2

About sodium 2-(4-ethenylphenyl)phenolate

sodium 2-(4-ethenylphenyl)phenolate (PubChem CID 142700332) has the molecular formula C14H11NaO and a molecular weight of 218.23 g/mol. Its IUPAC name is sodium 2-(4-ethenylphenyl)phenolate.

Molecular Properties

Compound Namesodium 2-(4-ethenylphenyl)phenolate
PubChem CID142700332
Molecular FormulaC14H11NaO
Molecular Weight218.23 g/mol
Exact Mass218.07
IUPAC Namesodium 2-(4-ethenylphenyl)phenolate
SMILESC=Cc1ccc(-c2ccccc2[O-])cc1.[Na+]
InChIInChI=1S/C14H12O.Na/c1-2-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15;/h2-10,15H,1H2;/q;+1/p-1
InChIKeyKDOPXZORNCEDKC-UHFFFAOYSA-M
XLogP0.07
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.23
LogP ≤ 50.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium 2-(4-ethenylphenyl)phenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(4-ethenylphenyl)phenolate?
The IUPAC name of sodium 2-(4-ethenylphenyl)phenolate (CID 142700332) is sodium 2-(4-ethenylphenyl)phenolate.
What is the SMILES notation for sodium 2-(4-ethenylphenyl)phenolate?
The canonical SMILES for sodium 2-(4-ethenylphenyl)phenolate is C=Cc1ccc(-c2ccccc2[O-])cc1.[Na+].
What is the InChIKey of sodium 2-(4-ethenylphenyl)phenolate?
The InChIKey is KDOPXZORNCEDKC-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12O.Na/c1-2-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15;/h2-10,15H,1H2;/q;+1/p-1.
What are the key properties of sodium 2-(4-ethenylphenyl)phenolate?
sodium 2-(4-ethenylphenyl)phenolate has a molecular weight of 218.23 g/mol, XLogP of 0.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(4-ethenylphenyl)phenolate is sourced from PubChem (CID 142700332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).