C42H32 — CID 140790330
1,3,5,7-tetrakis(4-ethenylphenyl)naphthalene (PubChem CID 140790330) has the molecular formula C42H32 and a molecular weight of 536.72 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(4-ethenylphenyl)naphthalene.
| Compound Name | 1,3,5,7-tetrakis(4-ethenylphenyl)naphthalene |
|---|---|
| PubChem CID | 140790330 |
| Molecular Formula | C42H32 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 1,3,5,7-tetrakis(4-ethenylphenyl)naphthalene |
| SMILES | C=Cc1ccc(-c2cc(-c3ccc(C=C)cc3)c3cc(-c4ccc(C=C)cc4)cc(-c4ccc(C=C)cc4)c3c2)cc1 |
| InChI | InChI=1S/C42H32/c1-5-29-9-17-33(18-10-29)37-25-39(35-21-13-31(7-3)14-22-35)42-28-38(34-19-11-30(6-2)12-20-34)26-40(41(42)27-37)36-23-15-32(8-4)16-24-36/h5-28H,1-4H2 |
| InChIKey | QRVVKSPDTULCEC-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |