C38H34 — CID 170691773
1,6-bis(4-ethenylphenyl)-3,8-di(propan-2-yl)pyrene (PubChem CID 170691773) has the molecular formula C38H34 and a molecular weight of 490.69 g/mol. Its IUPAC name is 1,6-bis(4-ethenylphenyl)-3,8-di(propan-2-yl)pyrene.
| Compound Name | 1,6-bis(4-ethenylphenyl)-3,8-di(propan-2-yl)pyrene |
|---|---|
| PubChem CID | 170691773 |
| Molecular Formula | C38H34 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1,6-bis(4-ethenylphenyl)-3,8-di(propan-2-yl)pyrene |
| SMILES | C=Cc1ccc(-c2cc(C(C)C)c3ccc4c(-c5ccc(C=C)cc5)cc(C(C)C)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C38H34/c1-7-25-9-13-27(14-10-25)35-21-33(23(3)4)29-18-20-32-36(28-15-11-26(8-2)12-16-28)22-34(24(5)6)30-17-19-31(35)37(29)38(30)32/h7-24H,1-2H2,3-6H3 |
| InChIKey | FGPUOCRMWXKRLH-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|