C37H32N4 — CID 90293484
2-[6-(4,6-dimethylpyrimidin-2-yl)-3-phenyl-8-propan-2-ylpyren-1-yl]-4,6-dimethylpyrimidine (PubChem CID 90293484) has the molecular formula C37H32N4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-[6-(4,6-dimethylpyrimidin-2-yl)-3-phenyl-8-propan-2-ylpyren-1-yl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[6-(4,6-dimethylpyrimidin-2-yl)-3-phenyl-8-propan-2-ylpyren-1-yl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 90293484 |
| Molecular Formula | C37H32N4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[6-(4,6-dimethylpyrimidin-2-yl)-3-phenyl-8-propan-2-ylpyren-1-yl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(-c2cc(-c3ccccc3)c3ccc4c(-c5nc(C)cc(C)n5)cc(C(C)C)c5ccc2c3c45)n1 |
| InChI | InChI=1S/C37H32N4/c1-20(2)30-18-32(36-38-21(3)16-22(4)39-36)28-15-13-27-31(25-10-8-7-9-11-25)19-33(37-40-23(5)17-24(6)41-37)29-14-12-26(30)34(28)35(27)29/h7-20H,1-6H3 |
| InChIKey | FZAQBLBEOQDDGD-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|