C45H41N3Si — CID 174156075
[6-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]-1,8-diphenylpyren-4-yl]-dimethyl-phenylsilane (PubChem CID 174156075) has the molecular formula C45H41N3Si and a molecular weight of 651.93 g/mol. Its IUPAC name is [6-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]-1,8-diphenylpyren-4-yl]-dimethyl-phenylsilane.
| Compound Name | [6-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]-1,8-diphenylpyren-4-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 174156075 |
| Molecular Formula | C45H41N3Si |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | [6-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]-1,8-diphenylpyren-4-yl]-dimethyl-phenylsilane |
| SMILES | CC(C)c1nc(-c2cc(-c3ccccc3)c3ccc4c(-c5ccccc5)ccc5c([Si](C)(C)c6ccccc6)cc2c3c45)nc(C(C)C)n1 |
| InChI | InChI=1S/C45H41N3Si/c1-28(2)43-46-44(29(3)4)48-45(47-43)39-26-37(31-18-12-8-13-19-31)35-24-23-34-33(30-16-10-7-11-17-30)22-25-36-40(27-38(39)42(35)41(34)36)49(5,6)32-20-14-9-15-21-32/h7-29H,1-6H3 |
| InChIKey | APBQXAZAHYDBKJ-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|