C36H29N3 — CID 166501233
2-(2,5-diphenylphenyl)-4-(2-phenylphenyl)-6-propan-2-yl-1,3,5-triazine (PubChem CID 166501233) has the molecular formula C36H29N3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 2-(2,5-diphenylphenyl)-4-(2-phenylphenyl)-6-propan-2-yl-1,3,5-triazine.
| Compound Name | 2-(2,5-diphenylphenyl)-4-(2-phenylphenyl)-6-propan-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 166501233 |
| Molecular Formula | C36H29N3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-(2,5-diphenylphenyl)-4-(2-phenylphenyl)-6-propan-2-yl-1,3,5-triazine |
| SMILES | CC(C)c1nc(-c2ccccc2-c2ccccc2)nc(-c2cc(-c3ccccc3)ccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C36H29N3/c1-25(2)34-37-35(32-21-13-12-20-30(32)27-16-8-4-9-17-27)39-36(38-34)33-24-29(26-14-6-3-7-15-26)22-23-31(33)28-18-10-5-11-19-28/h3-25H,1-2H3 |
| InChIKey | WYFXNAHRGXZMOO-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |