C54H32N10 — CID 146230581
2-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-3,8-diphenylpyren-1-yl]-4,6-dipyridin-3-yl-1,3,5-triazine (PubChem CID 146230581) has the molecular formula C54H32N10 and a molecular weight of 820.92 g/mol. Its IUPAC name is 2-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-3,8-diphenylpyren-1-yl]-4,6-dipyridin-3-yl-1,3,5-triazine.
| Compound Name | 2-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-3,8-diphenylpyren-1-yl]-4,6-dipyridin-3-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 146230581 |
| Molecular Formula | C54H32N10 |
| Molecular Weight | 820.92 g/mol |
| Exact Mass | 820.28 |
| IUPAC Name | 2-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)-3,8-diphenylpyren-1-yl]-4,6-dipyridin-3-yl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3nc(-c4cccnc4)nc(-c4cccnc4)n3)c3ccc4c(-c5ccccc5)cc(-c5nc(-c6cccnc6)nc(-c6cccnc6)n5)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C54H32N10/c1-3-11-33(12-4-1)43-27-45(53-61-49(35-15-7-23-55-29-35)59-50(62-53)36-16-8-24-56-30-36)41-22-20-40-44(34-13-5-2-6-14-34)28-46(42-21-19-39(43)47(41)48(40)42)54-63-51(37-17-9-25-57-31-37)60-52(64-54)38-18-10-26-58-32-38/h1-32H |
| InChIKey | AEMJXIIQGNGZKS-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.92 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|