C64H38N8 — CID 146230629
7-[4-[3,8-diphenyl-6-(4-phenyl-6-quinolin-7-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-phenyl-1,3,5-triazin-2-yl]quinoline (PubChem CID 146230629) has the molecular formula C64H38N8 and a molecular weight of 919.06 g/mol. Its IUPAC name is 7-[4-[3,8-diphenyl-6-(4-phenyl-6-quinolin-7-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-phenyl-1,3,5-triazin-2-yl]quinoline.
| Compound Name | 7-[4-[3,8-diphenyl-6-(4-phenyl-6-quinolin-7-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-phenyl-1,3,5-triazin-2-yl]quinoline |
|---|---|
| PubChem CID | 146230629 |
| Molecular Formula | C64H38N8 |
| Molecular Weight | 919.06 g/mol |
| Exact Mass | 918.32 |
| IUPAC Name | 7-[4-[3,8-diphenyl-6-(4-phenyl-6-quinolin-7-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-phenyl-1,3,5-triazin-2-yl]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccc4cccnc4c3)nc(-c3cc(-c4ccccc4)c4ccc5c(-c6nc(-c7ccccc7)nc(-c7ccc8cccnc8c7)n6)cc(-c6ccccc6)c6ccc3c4c65)n2)cc1 |
| InChI | InChI=1S/C64H38N8/c1-5-15-39(16-6-1)51-37-53(63-69-59(43-19-9-3-10-20-43)67-61(71-63)45-27-25-41-23-13-33-65-55(41)35-45)49-32-30-48-52(40-17-7-2-8-18-40)38-54(50-31-29-47(51)57(49)58(48)50)64-70-60(44-21-11-4-12-22-44)68-62(72-64)46-28-26-42-24-14-34-66-56(42)36-46/h1-38H |
| InChIKey | AHPAREUXWWRSLN-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.06 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|