C63H41N5 — CID 122415943
7-[3-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-5-quinolin-7-ylphenyl]quinoline (PubChem CID 122415943) has the molecular formula C63H41N5 and a molecular weight of 868.06 g/mol. Its IUPAC name is 7-[3-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-5-quinolin-7-ylphenyl]quinoline.
| Compound Name | 7-[3-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-5-quinolin-7-ylphenyl]quinoline |
|---|---|
| PubChem CID | 122415943 |
| Molecular Formula | C63H41N5 |
| Molecular Weight | 868.06 g/mol |
| Exact Mass | 867.34 |
| IUPAC Name | 7-[3-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-5-quinolin-7-ylphenyl]quinoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4cc(-c5ccc6cccnc6c5)cc(-c5ccc6cccnc6c5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C63H41N5/c1-5-15-42(16-6-1)50-31-51(43-17-7-2-8-18-43)35-56(34-50)61-66-62(57-36-52(44-19-9-3-10-20-44)32-53(37-57)45-21-11-4-12-22-45)68-63(67-61)58-38-54(48-27-25-46-23-13-29-64-59(46)40-48)33-55(39-58)49-28-26-47-24-14-30-65-60(47)41-49/h1-41H |
| InChIKey | SVZLOKKDAZMLIV-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.06 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |