C44H24N4O3 — CID 155077776
2-dibenzofuran-3-yl-4-(1-dibenzofuran-3-yldibenzofuran-4-yl)-6-pyridin-3-yl-1,3,5-triazine (PubChem CID 155077776) has the molecular formula C44H24N4O3 and a molecular weight of 656.70 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-(1-dibenzofuran-3-yldibenzofuran-4-yl)-6-pyridin-3-yl-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-(1-dibenzofuran-3-yldibenzofuran-4-yl)-6-pyridin-3-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 155077776 |
| Molecular Formula | C44H24N4O3 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-(1-dibenzofuran-3-yldibenzofuran-4-yl)-6-pyridin-3-yl-1,3,5-triazine |
| SMILES | c1cncc(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3ccc(-c4ccc5c(c4)oc4ccccc45)c4c3oc3ccccc34)n2)c1 |
| InChI | InChI=1S/C44H24N4O3/c1-4-12-35-29(9-1)31-17-15-25(22-38(31)49-35)28-19-20-34(41-40(28)33-11-3-6-14-37(33)51-41)44-47-42(46-43(48-44)27-8-7-21-45-24-27)26-16-18-32-30-10-2-5-13-36(30)50-39(32)23-26/h1-24H |
| InChIKey | CYGJMYASGRQYQT-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 90.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |