C68H58N8 — CID 176881504
1-N,6-N-bis(2,6-dimethylphenyl)-1-N,6-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 176881504) has the molecular formula C68H58N8 and a molecular weight of 987.27 g/mol. Its IUPAC name is 1-N,6-N-bis(2,6-dimethylphenyl)-1-N,6-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(2,6-dimethylphenyl)-1-N,6-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 176881504 |
| Molecular Formula | C68H58N8 |
| Molecular Weight | 987.27 g/mol |
| Exact Mass | 986.48 |
| IUPAC Name | 1-N,6-N-bis(2,6-dimethylphenyl)-1-N,6-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | Cc1cccc(C)c1N(c1nc(-c2ccccc2)nc(-c2ccccc2)n1)c1cc(C(C)C)c2ccc3c(N(c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4c(C)cccc4C)cc(C(C)C)c4ccc1c2c43 |
| InChI | InChI=1S/C68H58N8/c1-41(2)55-39-57(75(61-43(5)23-21-24-44(61)6)67-71-63(47-27-13-9-14-28-47)69-64(72-67)48-29-15-10-16-30-48)53-38-36-52-56(42(3)4)40-58(54-37-35-51(55)59(53)60(52)54)76(62-45(7)25-22-26-46(62)8)68-73-65(49-31-17-11-18-32-49)70-66(74-68)50-33-19-12-20-34-50/h9-42H,1-8H3 |
| InChIKey | SWUHLBJEPJYBKD-UHFFFAOYSA-N |
| XLogP | 18.04 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.27 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|