C79H62N4 — CID 171053082
1-N,1-N,3-N,6-N,6-N,8-N,8-N-heptakis(4-ethenylphenyl)-3-N-(4-methylphenyl)pyrene-1,3,6,8-tetramine (PubChem CID 171053082) has the molecular formula C79H62N4 and a molecular weight of 1067.39 g/mol. Its IUPAC name is 1-N,1-N,3-N,6-N,6-N,8-N,8-N-heptakis(4-ethenylphenyl)-3-N-(4-methylphenyl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,1-N,3-N,6-N,6-N,8-N,8-N-heptakis(4-ethenylphenyl)-3-N-(4-methylphenyl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 171053082 |
| Molecular Formula | C79H62N4 |
| Molecular Weight | 1067.39 g/mol |
| Exact Mass | 1066.50 |
| IUPAC Name | 1-N,1-N,3-N,6-N,6-N,8-N,8-N-heptakis(4-ethenylphenyl)-3-N-(4-methylphenyl)pyrene-1,3,6,8-tetramine |
| SMILES | C=Cc1ccc(N(c2ccc(C)cc2)c2cc(N(c3ccc(C=C)cc3)c3ccc(C=C)cc3)c3ccc4c(N(c5ccc(C=C)cc5)c5ccc(C=C)cc5)cc(N(c5ccc(C=C)cc5)c5ccc(C=C)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C79H62N4/c1-9-55-18-34-63(35-19-55)80(62-32-16-54(8)17-33-62)74-52-75(81(64-36-20-56(10-2)21-37-64)65-38-22-57(11-3)23-39-65)71-50-51-73-77(83(68-44-28-60(14-6)29-45-68)69-46-30-61(15-7)31-47-69)53-76(72-49-48-70(74)78(71)79(72)73)82(66-40-24-58(12-4)25-41-66)67-42-26-59(13-5)27-43-67/h9-53H,1-7H2,8H3 |
| InChIKey | VXKILGAXAMOZBG-UHFFFAOYSA-N |
| XLogP | 23.27 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.39 |
| LogP ≤ 5 | 23.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|