C88H94N4 — CID 59309194
1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,3,4,5,6-pentamethylphenyl)pyrene-1,3,6,8-tetramine (PubChem CID 59309194) has the molecular formula C88H94N4 and a molecular weight of 1207.75 g/mol. Its IUPAC name is 1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,3,4,5,6-pentamethylphenyl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,3,4,5,6-pentamethylphenyl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 59309194 |
| Molecular Formula | C88H94N4 |
| Molecular Weight | 1207.75 g/mol |
| Exact Mass | 1206.75 |
| IUPAC Name | 1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,3,4,5,6-pentamethylphenyl)pyrene-1,3,6,8-tetramine |
| SMILES | Cc1ccc(N(c2c(C)c(C)c(C)c(C)c2C)c2cc(N(c3ccc(C)cc3)c3c(C)c(C)c(C)c(C)c3C)c3ccc4c(N(c5ccc(C)cc5)c5c(C)c(C)c(C)c(C)c5C)cc(N(c5ccc(C)cc5)c5c(C)c(C)c(C)c(C)c5C)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C88H94N4/c1-47-25-33-71(34-26-47)89(85-63(17)55(9)51(5)56(10)64(85)18)79-45-80(90(72-35-27-48(2)28-36-72)86-65(19)57(11)52(6)58(12)66(86)20)76-43-44-78-82(92(74-39-31-50(4)32-40-74)88-69(23)61(15)54(8)62(16)70(88)24)46-81(77-42-41-75(79)83(76)84(77)78)91(73-37-29-49(3)30-38-73)87-67(21)59(13)53(7)60(14)68(87)22/h25-46H,1-24H3 |
| InChIKey | BEESJZTVQFPBQR-UHFFFAOYSA-N |
| XLogP | 25.87 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1207.75 |
| LogP ≤ 5 | 25.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|