C72H68N2 — CID 20758354
2,3,5,6-tetramethyl-N,N-bis[4-(4-methylphenyl)phenyl]-4-[2,3,5,6-tetramethyl-4-[4-(4-methylphenyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]aniline (PubChem CID 20758354) has the molecular formula C72H68N2 and a molecular weight of 961.35 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N,N-bis[4-(4-methylphenyl)phenyl]-4-[2,3,5,6-tetramethyl-4-[4-(4-methylphenyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]aniline.
| Compound Name | 2,3,5,6-tetramethyl-N,N-bis[4-(4-methylphenyl)phenyl]-4-[2,3,5,6-tetramethyl-4-[4-(4-methylphenyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]aniline |
|---|---|
| PubChem CID | 20758354 |
| Molecular Formula | C72H68N2 |
| Molecular Weight | 961.35 g/mol |
| Exact Mass | 960.54 |
| IUPAC Name | 2,3,5,6-tetramethyl-N,N-bis[4-(4-methylphenyl)phenyl]-4-[2,3,5,6-tetramethyl-4-[4-(4-methylphenyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]aniline |
| SMILES | Cc1ccc(-c2ccc(N(c3ccc(-c4ccc(C)cc4)cc3)c3c(C)c(C)c(-c4c(C)c(C)c(N(c5ccc(-c6ccc(C)cc6)cc5)c5ccc(-c6ccc(C)cc6)cc5)c(C)c4C)c(C)c3C)cc2)cc1 |
| InChI | InChI=1S/C72H68N2/c1-45-13-21-57(22-14-45)61-29-37-65(38-30-61)73(66-39-31-62(32-40-66)58-23-15-46(2)16-24-58)71-53(9)49(5)69(50(6)54(71)10)70-51(7)55(11)72(56(12)52(70)8)74(67-41-33-63(34-42-67)59-25-17-47(3)18-26-59)68-43-35-64(36-44-68)60-27-19-48(4)20-28-60/h13-44H,1-12H3 |
| InChIKey | QOMIRCNLBVDDQA-UHFFFAOYSA-N |
| XLogP | 20.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.35 |
| LogP ≤ 5 | 20.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |