C50H44F4N2 — CID 118299311
2,3,5,6-tetramethyl-N,N-diphenyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetramethyl-4-(N-phenylanilino)phenyl]phenyl]aniline (PubChem CID 118299311) has the molecular formula C50H44F4N2 and a molecular weight of 748.91 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N,N-diphenyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetramethyl-4-(N-phenylanilino)phenyl]phenyl]aniline.
| Compound Name | 2,3,5,6-tetramethyl-N,N-diphenyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetramethyl-4-(N-phenylanilino)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 118299311 |
| Molecular Formula | C50H44F4N2 |
| Molecular Weight | 748.91 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | 2,3,5,6-tetramethyl-N,N-diphenyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetramethyl-4-(N-phenylanilino)phenyl]phenyl]aniline |
| SMILES | Cc1c(C)c(N(c2ccccc2)c2ccccc2)c(C)c(C)c1-c1c(F)c(F)c(-c2c(C)c(C)c(N(c3ccccc3)c3ccccc3)c(C)c2C)c(F)c1F |
| InChI | InChI=1S/C50H44F4N2/c1-29-33(5)49(55(37-21-13-9-14-22-37)38-23-15-10-16-24-38)34(6)30(2)41(29)43-45(51)47(53)44(48(54)46(43)52)42-31(3)35(7)50(36(8)32(42)4)56(39-25-17-11-18-26-39)40-27-19-12-20-28-40/h9-28H,1-8H3 |
| InChIKey | DKONCADMWFFMNA-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.91 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|