C14H11N3OS — CID 62898416
4-(2-phenylphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 62898416) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(2-phenylphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(2-phenylphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 62898416 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-(2-phenylphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C14H11N3OS/c18-13-15-16-14(19)17(13)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H,15,18)(H,16,19) |
| InChIKey | QXLHECHKCPMZKY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|