C17H10N2O2 — CID 162734807
1-phenylimidazo[1,2-a]quinoline-4,5-dione (PubChem CID 162734807) has the molecular formula C17H10N2O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-phenylimidazo[1,2-a]quinoline-4,5-dione.
| Compound Name | 1-phenylimidazo[1,2-a]quinoline-4,5-dione |
|---|---|
| PubChem CID | 162734807 |
| Molecular Formula | C17H10N2O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-phenylimidazo[1,2-a]quinoline-4,5-dione |
| SMILES | O=C1C(=O)c2ncc(-c3ccccc3)n2-c2ccccc21 |
| InChI | InChI=1S/C17H10N2O2/c20-15-12-8-4-5-9-13(12)19-14(10-18-17(19)16(15)21)11-6-2-1-3-7-11/h1-10H |
| InChIKey | UNFFQYXMMBBJPM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|