C11H11N3OS — CID 62898212
4-(2-phenylcyclopropyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 62898212) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 4-(2-phenylcyclopropyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(2-phenylcyclopropyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 62898212 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-(2-phenylcyclopropyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1C1CC1c1ccccc1 |
| InChI | InChI=1S/C11H11N3OS/c15-10-12-13-11(16)14(10)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,12,15)(H,13,16) |
| InChIKey | OJICTCUUBQSQPK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|