C15H19N3O2 — CID 155250067
1-[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide (PubChem CID 155250067) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide.
| Compound Name | 1-[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 155250067 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide |
| SMILES | NC(=O)C1CN([C@H]2C[C@@H]2c2ccccc2)CC1C(N)=O |
| InChI | InChI=1S/C15H19N3O2/c16-14(19)11-7-18(8-12(11)15(17)20)13-6-10(13)9-4-2-1-3-5-9/h1-5,10-13H,6-8H2,(H2,16,19)(H2,17,20)/t10-,11?,12?,13+/m1/s1 |
| InChIKey | FFZAYTQEVJYNOG-XVSSEFHLSA-N |
| XLogP | 0.06 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |