About 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide
2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide (PubChem CID 114263437) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide |
| PubChem CID | 114263437 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide |
| SMILES | CC(C(N)=O)N1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H19N3O/c1-9(13(15)17)16-7-11(12(14)8-16)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8,14H2,1H3,(H2,15,17)/t9?,11-,12+/m0/s1 |
| InChIKey | QTFRVQDZQIUOFZ-CLGJWYQZSA-N |
| XLogP | 0.29 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide?
The IUPAC name of 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide (CID 114263437) is 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide.
What is the SMILES notation for 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide?
The canonical SMILES for 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide is CC(C(N)=O)N1C[C@@H](N)[C@H](c2ccccc2)C1.
What is the InChIKey of 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide?
The InChIKey is QTFRVQDZQIUOFZ-CLGJWYQZSA-N. The full InChI is InChI=1S/C13H19N3O/c1-9(13(15)17)16-7-11(12(14)8-16)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8,14H2,1H3,(H2,15,17)/t9?,11-,12+/m0/s1.
What are the key properties of 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide?
2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide has a molecular weight of 233.31 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]propanamide is sourced from PubChem (CID 114263437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).