C19H29N3O — CID 120760507
2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-1-(azepan-1-yl)propan-1-one (PubChem CID 120760507) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-1-(azepan-1-yl)propan-1-one.
| Compound Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-1-(azepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 120760507 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-1-(azepan-1-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCCCCC1)N1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H29N3O/c1-15(19(23)21-11-7-2-3-8-12-21)22-13-17(18(20)14-22)16-9-5-4-6-10-16/h4-6,9-10,15,17-18H,2-3,7-8,11-14,20H2,1H3/t15?,17-,18+/m0/s1 |
| InChIKey | KRYZGYLQTOTDOX-XSRYCBBQSA-N |
| XLogP | 2.20 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |