C20H31N3O — CID 120761631
2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(4-methylcyclohexyl)propanamide (PubChem CID 120761631) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(4-methylcyclohexyl)propanamide.
| Compound Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(4-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 120761631 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(4-methylcyclohexyl)propanamide |
| SMILES | CC1CCC(NC(=O)C(C)N2C[C@@H](N)[C@H](c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C20H31N3O/c1-14-8-10-17(11-9-14)22-20(24)15(2)23-12-18(19(21)13-23)16-6-4-3-5-7-16/h3-7,14-15,17-19H,8-13,21H2,1-2H3,(H,22,24)/t14?,15?,17?,18-,19+/m0/s1 |
| InChIKey | DTJQNGVYJJBYIV-WHOWFZBVSA-N |
| XLogP | 2.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |