C48H29N3Pt — CID 171043699
9-phenyl-2-[5-phenyl-3-(8-phenyl-3H-naphthalen-3-id-2-yl)isoquinolin-1-yl]pyrido[2,3-b]indole;platinum(2+) (PubChem CID 171043699) has the molecular formula C48H29N3Pt and a molecular weight of 842.86 g/mol. Its IUPAC name is 9-phenyl-2-[5-phenyl-3-(8-phenyl-3H-naphthalen-3-id-2-yl)isoquinolin-1-yl]pyrido[2,3-b]indole;platinum(2+).
| Compound Name | 9-phenyl-2-[5-phenyl-3-(8-phenyl-3H-naphthalen-3-id-2-yl)isoquinolin-1-yl]pyrido[2,3-b]indole;platinum(2+) |
|---|---|
| PubChem CID | 171043699 |
| Molecular Formula | C48H29N3Pt |
| Molecular Weight | 842.86 g/mol |
| Exact Mass | 842.20 |
| IUPAC Name | 9-phenyl-2-[5-phenyl-3-(8-phenyl-3H-naphthalen-3-id-2-yl)isoquinolin-1-yl]pyrido[2,3-b]indole;platinum(2+) |
| SMILES | [Pt+2].[c-]1cc2cccc(-c3ccccc3)c2cc1-c1cc2c(-c3ccccc3)cccc2c(-c2ccc3c4ccccc4n(-c4[c-]cccc4)c3n2)n1 |
| InChI | InChI=1S/C48H29N3.Pt/c1-4-14-32(15-5-1)37-22-12-18-34-26-27-35(30-42(34)37)45-31-43-38(33-16-6-2-7-17-33)23-13-24-40(43)47(49-45)44-29-28-41-39-21-10-11-25-46(39)51(48(41)50-44)36-19-8-3-9-20-36;/h1-19,21-26,28-31H;/q-2;+2 |
| InChIKey | PRWMVFXZSDJPFY-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.86 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|