C29H20N3Pt+ — CID 168743670
1-methyl-2-phenyl-9-(6-phenyl-2-pyridinyl)pyrido[2,3-b]indol-1-ium;platinum(2+) (PubChem CID 168743670) has the molecular formula C29H20N3Pt+ and a molecular weight of 605.58 g/mol. Its IUPAC name is 1-methyl-2-phenyl-9-(6-phenyl-2-pyridinyl)pyrido[2,3-b]indol-1-ium;platinum(2+).
| Compound Name | 1-methyl-2-phenyl-9-(6-phenyl-2-pyridinyl)pyrido[2,3-b]indol-1-ium;platinum(2+) |
|---|---|
| PubChem CID | 168743670 |
| Molecular Formula | C29H20N3Pt+ |
| Molecular Weight | 605.58 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | 1-methyl-2-phenyl-9-(6-phenyl-2-pyridinyl)pyrido[2,3-b]indol-1-ium;platinum(2+) |
| SMILES | C[n+]1c(-c2[c-]cccc2)ccc2c3ccccc3n(-c3cccc(-c4[c-]cccc4)n3)c21.[Pt+2] |
| InChI | InChI=1S/C29H20N3.Pt/c1-31-26(22-13-6-3-7-14-22)20-19-24-23-15-8-9-17-27(23)32(29(24)31)28-18-10-16-25(30-28)21-11-4-2-5-12-21;/h2-11,13,15-20H,1H3;/q-1;+2 |
| InChIKey | JLAJADDGRKEMTP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|