C41H32N5O+ — CID 165164176
10-[3-(2,3-dimethylimidazol-3-ium-1-yl)phenyl]-2-(4-methoxyphenyl)-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene (PubChem CID 165164176) has the molecular formula C41H32N5O+ and a molecular weight of 610.74 g/mol. Its IUPAC name is 10-[3-(2,3-dimethylimidazol-3-ium-1-yl)phenyl]-2-(4-methoxyphenyl)-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene.
| Compound Name | 10-[3-(2,3-dimethylimidazol-3-ium-1-yl)phenyl]-2-(4-methoxyphenyl)-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 165164176 |
| Molecular Formula | C41H32N5O+ |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 10-[3-(2,3-dimethylimidazol-3-ium-1-yl)phenyl]-2-(4-methoxyphenyl)-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene |
| SMILES | COc1ccc(-c2c3c4ccccc4n(-c4ccccc4)c3nc3c2c2ccccc2n3-c2cccc(-n3cc[n+](C)c3C)c2)cc1 |
| InChI | InChI=1S/C41H32N5O/c1-27-43(2)24-25-44(27)30-14-11-15-31(26-30)46-36-19-10-8-17-34(36)39-37(28-20-22-32(47-3)23-21-28)38-33-16-7-9-18-35(33)45(40(38)42-41(39)46)29-12-5-4-6-13-29/h4-26H,1-3H3/q+1 |
| InChIKey | VLGDMNBIYBYZCW-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|