C35H27N5 — CID 165164098
6,18-dimethyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene (PubChem CID 165164098) has the molecular formula C35H27N5 and a molecular weight of 517.64 g/mol. Its IUPAC name is 6,18-dimethyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene.
| Compound Name | 6,18-dimethyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 165164098 |
| Molecular Formula | C35H27N5 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 6,18-dimethyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene |
| SMILES | Cc1ccc2c(c1)c1cc3c4cc(C)ccc4n(-c4cccc(-n5[c-][n+](C)cc5)c4)c3nc1n2-c1ccccc1 |
| InChI | InChI=1S/C35H27N5/c1-23-12-14-32-28(18-23)30-21-31-29-19-24(2)13-15-33(29)40(27-11-7-10-26(20-27)38-17-16-37(3)22-38)35(31)36-34(30)39(32)25-8-5-4-6-9-25/h4-21H,1-3H3 |
| InChIKey | XEXMQMDVLSOKDX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 31.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|