C37H38N2Pt — CID 162771223
2-(3-tert-butylbenzene-6-id-1-yl)-4,5-dimethylpyridine;4-(2,4-dimethylphenyl)-5-methyl-2-phenylpyridine;platinum(2+) (PubChem CID 162771223) has the molecular formula C37H38N2Pt and a molecular weight of 705.80 g/mol. Its IUPAC name is 2-(3-tert-butylbenzene-6-id-1-yl)-4,5-dimethylpyridine;4-(2,4-dimethylphenyl)-5-methyl-2-phenylpyridine;platinum(2+).
| Compound Name | 2-(3-tert-butylbenzene-6-id-1-yl)-4,5-dimethylpyridine;4-(2,4-dimethylphenyl)-5-methyl-2-phenylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 162771223 |
| Molecular Formula | C37H38N2Pt |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | 2-(3-tert-butylbenzene-6-id-1-yl)-4,5-dimethylpyridine;4-(2,4-dimethylphenyl)-5-methyl-2-phenylpyridine;platinum(2+) |
| SMILES | Cc1ccc(-c2cc(-c3[c-]cccc3)ncc2C)c(C)c1.Cc1cnc(-c2[c-]ccc(C(C)(C)C)c2)cc1C.[Pt+2] |
| InChI | InChI=1S/C20H18N.C17H20N.Pt/c1-14-9-10-18(15(2)11-14)19-12-20(21-13-16(19)3)17-7-5-4-6-8-17;1-12-9-16(18-11-13(12)2)14-7-6-8-15(10-14)17(3,4)5;/h4-7,9-13H,1-3H3;6,8-11H,1-5H3;/q2*-1;+2 |
| InChIKey | DLJAGDVVCQCHPG-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|