C34H31IrN3-2 — CID 171590614
iridium;4-methyl-2-(9,9,10,10-tetramethyl-2H-anthracen-2-id-1-yl)pyridine;2-phenylpyrazine (PubChem CID 171590614) has the molecular formula C34H31IrN3-2 and a molecular weight of 673.86 g/mol. Its IUPAC name is iridium;4-methyl-2-(9,9,10,10-tetramethyl-2H-anthracen-2-id-1-yl)pyridine;2-phenylpyrazine.
| Compound Name | iridium;4-methyl-2-(9,9,10,10-tetramethyl-2H-anthracen-2-id-1-yl)pyridine;2-phenylpyrazine |
|---|---|
| PubChem CID | 171590614 |
| Molecular Formula | C34H31IrN3-2 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | iridium;4-methyl-2-(9,9,10,10-tetramethyl-2H-anthracen-2-id-1-yl)pyridine;2-phenylpyrazine |
| SMILES | Cc1ccnc(-c2[c-]ccc3c2C(C)(C)c2ccccc2C3(C)C)c1.[Ir].[c-]1ccccc1-c1cnccn1 |
| InChI | InChI=1S/C24H24N.C10H7N2.Ir/c1-16-13-14-25-21(15-16)17-9-8-12-20-22(17)24(4,5)19-11-7-6-10-18(19)23(20,2)3;1-2-4-9(5-3-1)10-8-11-6-7-12-10;/h6-8,10-15H,1-5H3;1-4,6-8H;/q2*-1; |
| InChIKey | PJIXEYJLUYBLDB-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|