C41H31IrN3-2 — CID 164734290
CID 164734290 (PubChem CID 164734290) has the molecular formula C41H31IrN3-2 and a molecular weight of 757.94 g/mol.
| Compound Name | CID 164734290 |
|---|---|
| PubChem CID | 164734290 |
| Molecular Formula | C41H31IrN3-2 |
| Molecular Weight | 757.94 g/mol |
| Exact Mass | 758.22 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2C2(C)c3c(cccc31)-c1ccc[c-]c1-c1nc3ccccc3n12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C30H23N2.C11H8N.Ir/c1-29(2)22-14-6-7-15-23(22)30(3)27-20(13-10-16-24(27)29)19-11-4-5-12-21(19)28-31-25-17-8-9-18-26(25)32(28)30;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-11,13-18H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | SKAOILOIKKXSHF-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.94 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|