About CID 177271340
CID 177271340 (PubChem CID 177271340) has the molecular formula C34H21IrN3-2
and a molecular weight of 663.78 g/mol.
Molecular Properties
| Compound Name | CID 177271340 |
| PubChem CID | 177271340 |
| Molecular Formula | C34H21IrN3-2 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 664.14 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cccc2c1-c1ncccc1-n1c3ccccc3c3cccc-2c31.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C23H13N2.C11H8N.Ir/c1-2-9-17-15(7-1)18-10-5-11-19-16-8-3-4-12-20(16)25(23(18)19)21-13-6-14-24-22(17)21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8,10-14H;1-6,8-9H;/q2*-1; |
| InChIKey | JSHQTZMPGFAONW-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 177271340 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177271340?
The IUPAC name of CID 177271340 (CID 177271340) is not available.
What is the SMILES notation for CID 177271340?
The canonical SMILES for CID 177271340 is [Ir].[c-]1cccc2c1-c1ncccc1-n1c3ccccc3c3cccc-2c31.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 177271340?
The InChIKey is JSHQTZMPGFAONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13N2.C11H8N.Ir/c1-2-9-17-15(7-1)18-10-5-11-19-16-8-3-4-12-20(16)25(23(18)19)21-13-6-14-24-22(17)21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8,10-14H;1-6,8-9H;/q2*-1;.
What are the key properties of CID 177271340?
CID 177271340 has a molecular weight of 663.78 g/mol, XLogP of 8.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177271340 is sourced from PubChem (CID 177271340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).