C36H40IrN6-2 — CID 140687839
CID 140687839 (PubChem CID 140687839) has the molecular formula C36H40IrN6-2 and a molecular weight of 748.98 g/mol.
| Compound Name | CID 140687839 |
|---|---|
| PubChem CID | 140687839 |
| Molecular Formula | C36H40IrN6-2 |
| Molecular Weight | 748.98 g/mol |
| Exact Mass | 749.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1nc[c-]c2c1ccn1c3cc4c(cc3nc21)C(C)(C)C(C)(C)C4(C)C.Cn1cnc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C27H32N3.C9H8N3.Ir/c1-24(2,3)22-16-11-13-30-21-15-19-18(25(4,5)27(8,9)26(19,6)7)14-20(21)29-23(30)17(16)10-12-28-22;1-12-7-10-9(11-12)8-5-3-2-4-6-8;/h11-15H,1-9H3;2-5,7H,1H3;/q2*-1; |
| InChIKey | FDRMAHOMRDKGLB-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.98 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|