C41H38N4Pt — CID 164805004
CID 164805004 (PubChem CID 164805004) has the molecular formula C41H38N4Pt and a molecular weight of 781.86 g/mol.
| Compound Name | CID 164805004 |
|---|---|
| PubChem CID | 164805004 |
| Molecular Formula | C41H38N4Pt |
| Molecular Weight | 781.86 g/mol |
| Exact Mass | 781.27 |
| IUPAC Name | — |
| SMILES | CC(C)(c1cccc(-c2[c-]cc3c(c2)C(C)(C)C(C)(C)C3(C)C)n1)c1ccc2c(n1)c1[c-]cccc1c1nc3ccccc3n21.[Pt+2] |
| InChI | InChI=1S/C41H38N4.Pt/c1-38(2,34-19-13-17-30(42-34)25-20-21-28-29(24-25)40(5,6)41(7,8)39(28,3)4)35-23-22-33-36(44-35)26-14-9-10-15-27(26)37-43-31-16-11-12-18-32(31)45(33)37;/h9-13,15-19,21-24H,1-8H3;/q-2;+2 |
| InChIKey | PYZMBKIXEXQXAP-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.86 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|