C33H38BN2 — CID 161026691
CID 161026691 (PubChem CID 161026691) has the molecular formula C33H38BN2 and a molecular weight of 473.49 g/mol.
| Compound Name | CID 161026691 |
|---|---|
| PubChem CID | 161026691 |
| Molecular Formula | C33H38BN2 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Cc1ccc2c(c1)c1ccccc1c1nc3cc4c(cc3n21)C(C)(C)C(C)(C)C4(C)C.[B] |
| InChI | InChI=1S/C33H38N2.B/c1-30(2,3)19-20-14-15-27-23(16-20)21-12-10-11-13-22(21)29-34-26-17-24-25(18-28(26)35(27)29)32(6,7)33(8,9)31(24,4)5;/h10-18H,19H2,1-9H3; |
| InChIKey | PMEJJUOPNPBEIN-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|