About CID 161026691
CID 161026691 (PubChem CID 161026691) has the molecular formula C33H38BN2
and a molecular weight of 473.49 g/mol.
Molecular Properties
| Compound Name | CID 161026691 |
| PubChem CID | 161026691 |
| Molecular Formula | C33H38BN2 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Cc1ccc2c(c1)c1ccccc1c1nc3cc4c(cc3n21)C(C)(C)C(C)(C)C4(C)C.[B] |
| InChI | InChI=1S/C33H38N2.B/c1-30(2,3)19-20-14-15-27-23(16-20)21-12-10-11-13-22(21)29-34-26-17-24-25(18-28(26)35(27)29)32(6,7)33(8,9)31(24,4)5;/h10-18H,19H2,1-9H3; |
| InChIKey | PMEJJUOPNPBEIN-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 161026691 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161026691?
The IUPAC name of CID 161026691 (CID 161026691) is not available.
What is the SMILES notation for CID 161026691?
The canonical SMILES for CID 161026691 is CC(C)(C)Cc1ccc2c(c1)c1ccccc1c1nc3cc4c(cc3n21)C(C)(C)C(C)(C)C4(C)C.[B].
What is the InChIKey of CID 161026691?
The InChIKey is PMEJJUOPNPBEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H38N2.B/c1-30(2,3)19-20-14-15-27-23(16-20)21-12-10-11-13-22(21)29-34-26-17-24-25(18-28(26)35(27)29)32(6,7)33(8,9)31(24,4)5;/h10-18H,19H2,1-9H3;.
What are the key properties of CID 161026691?
CID 161026691 has a molecular weight of 473.49 g/mol, XLogP of 8.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161026691 is sourced from PubChem (CID 161026691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).