C25H30N2 — CID 58163115
3,7-bis(2,2-dimethylpropyl)imidazo[1,2-f]phenanthridine (PubChem CID 58163115) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 3,7-bis(2,2-dimethylpropyl)imidazo[1,2-f]phenanthridine.
| Compound Name | 3,7-bis(2,2-dimethylpropyl)imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 58163115 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 3,7-bis(2,2-dimethylpropyl)imidazo[1,2-f]phenanthridine |
| SMILES | CC(C)(C)Cc1ccc2c(c1)c1ccccc1c1ncc(CC(C)(C)C)n21 |
| InChI | InChI=1S/C25H30N2/c1-24(2,3)14-17-11-12-22-21(13-17)19-9-7-8-10-20(19)23-26-16-18(27(22)23)15-25(4,5)6/h7-13,16H,14-15H2,1-6H3 |
| InChIKey | DIUZKQQTWUUGQR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|