C38H52N2 — CID 144979771
7-(2,2-dimethylpropyl)-3-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[1,2-f]phenanthridine;ethane;propane (PubChem CID 144979771) has the molecular formula C38H52N2 and a molecular weight of 536.85 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-3-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[1,2-f]phenanthridine;ethane;propane.
| Compound Name | 7-(2,2-dimethylpropyl)-3-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[1,2-f]phenanthridine;ethane;propane |
|---|---|
| PubChem CID | 144979771 |
| Molecular Formula | C38H52N2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-3-[2,6-di(propan-2-yl)phenyl]-2-methylimidazo[1,2-f]phenanthridine;ethane;propane |
| SMILES | CC.CCC.Cc1nc2c3ccccc3c3cc(CC(C)(C)C)ccc3n2c1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C33H38N2.C3H8.C2H6/c1-20(2)24-14-11-15-25(21(3)4)30(24)31-22(5)34-32-27-13-10-9-12-26(27)28-18-23(19-33(6,7)8)16-17-29(28)35(31)32;1-3-2;1-2/h9-18,20-21H,19H2,1-8H3;3H2,1-2H3;1-2H3 |
| InChIKey | VZCUWBVSYAPDSP-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|