C29H33N3 — CID 163422721
5,18-bis(2,2-dimethylpropyl)-3-methyl-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene (PubChem CID 163422721) has the molecular formula C29H33N3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 5,18-bis(2,2-dimethylpropyl)-3-methyl-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene.
| Compound Name | 5,18-bis(2,2-dimethylpropyl)-3-methyl-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene |
|---|---|
| PubChem CID | 163422721 |
| Molecular Formula | C29H33N3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 5,18-bis(2,2-dimethylpropyl)-3-methyl-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene |
| SMILES | Cc1cc(CC(C)(C)C)nc2c3ccccc3n3c4ccc(CC(C)(C)C)cc4nc3c12 |
| InChI | InChI=1S/C29H33N3/c1-18-14-20(17-29(5,6)7)30-26-21-10-8-9-11-23(21)32-24-13-12-19(16-28(2,3)4)15-22(24)31-27(32)25(18)26/h8-15H,16-17H2,1-7H3 |
| InChIKey | AJUWVPGXHYCHER-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|