C40H43IN2 — CID 170234367
9,20,24-tris(2,2-dimethylpropyl)-10-iodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene (PubChem CID 170234367) has the molecular formula C40H43IN2 and a molecular weight of 678.70 g/mol. Its IUPAC name is 9,20,24-tris(2,2-dimethylpropyl)-10-iodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene.
| Compound Name | 9,20,24-tris(2,2-dimethylpropyl)-10-iodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 170234367 |
| Molecular Formula | C40H43IN2 |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 9,20,24-tris(2,2-dimethylpropyl)-10-iodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
| SMILES | CC(C)(C)Cc1ccc2c(CC(C)(C)C)c3c(cc2c1)c1nccc2c(I)c(CC(C)(C)C)c4c5ccccc5n3c4c21 |
| InChI | InChI=1S/C40H43IN2/c1-38(2,3)20-23-14-15-25-24(18-23)19-28-35-33-27(16-17-42-35)34(41)30(22-40(7,8)9)32-26-12-10-11-13-31(26)43(37(32)33)36(28)29(25)21-39(4,5)6/h10-19H,20-22H2,1-9H3 |
| InChIKey | VKOHYPAGOYHOCB-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.70 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|