C45H54N2 — CID 170234459
5,9,20,24-tetrakis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8,10,12,14,16(25),17,19,21,23,26-tridecaene (PubChem CID 170234459) has the molecular formula C45H54N2 and a molecular weight of 622.94 g/mol. Its IUPAC name is 5,9,20,24-tetrakis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8,10,12,14,16(25),17,19,21,23,26-tridecaene.
| Compound Name | 5,9,20,24-tetrakis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8,10,12,14,16(25),17,19,21,23,26-tridecaene |
|---|---|
| PubChem CID | 170234459 |
| Molecular Formula | C45H54N2 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.43 |
| IUPAC Name | 5,9,20,24-tetrakis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8,10,12,14,16(25),17,19,21,23,26-tridecaene |
| SMILES | CC(C)(C)Cc1ccc2c(CC(C)(C)C)c3c(cc2c1)c1nccc2cc(CC(C)(C)C)c4c5cc(CC(C)(C)C)ccc5n3c4c21 |
| InChI | InChI=1S/C45H54N2/c1-42(2,3)23-27-13-15-32-30(19-27)22-34-39-38-29(17-18-46-39)21-31(25-44(7,8)9)37-33-20-28(24-43(4,5)6)14-16-36(33)47(41(37)38)40(34)35(32)26-45(10,11)12/h13-22H,23-26H2,1-12H3 |
| InChIKey | PFQOYUCEPPITBC-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|